About 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid
3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid (PubChem CID 19820541) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| PubChem CID | 19820541 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| SMILES | CC1(C(=O)O)Cc2ccccc2NC1=O |
| InChI | InChI=1S/C11H11NO3/c1-11(10(14)15)6-7-4-2-3-5-8(7)12-9(11)13/h2-5H,6H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | ZSTNDRNEHHDPQB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid?
The IUPAC name of 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid (CID 19820541) is 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid.
What is the SMILES notation for 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid?
The canonical SMILES for 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid is CC1(C(=O)O)Cc2ccccc2NC1=O.
What is the InChIKey of 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid?
The InChIKey is ZSTNDRNEHHDPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-11(10(14)15)6-7-4-2-3-5-8(7)12-9(11)13/h2-5H,6H2,1H3,(H,12,13)(H,14,15).
What are the key properties of 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid?
3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid has a molecular weight of 205.21 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylic acid is sourced from PubChem (CID 19820541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).