C17H35N3 — CID 19820920
N-[3-(3,3,5,5-tetramethylpiperazin-1-yl)propyl]cyclohexanamine (PubChem CID 19820920) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is N-[3-(3,3,5,5-tetramethylpiperazin-1-yl)propyl]cyclohexanamine.
| Compound Name | N-[3-(3,3,5,5-tetramethylpiperazin-1-yl)propyl]cyclohexanamine |
|---|---|
| PubChem CID | 19820920 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | N-[3-(3,3,5,5-tetramethylpiperazin-1-yl)propyl]cyclohexanamine |
| SMILES | CC1(C)CN(CCCNC2CCCCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H35N3/c1-16(2)13-20(14-17(3,4)19-16)12-8-11-18-15-9-6-5-7-10-15/h15,18-19H,5-14H2,1-4H3 |
| InChIKey | VRZCBFPFRJTFCE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|