About 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol
2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol (PubChem CID 19821122) has the molecular formula C6H12N6O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol |
| PubChem CID | 19821122 |
| Molecular Formula | C6H12N6O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol |
| SMILES | Nc1nc(N)c(N)c(NCCO)n1 |
| InChI | InChI=1S/C6H12N6O/c7-3-4(8)11-6(9)12-5(3)10-1-2-13/h13H,1-2,7H2,(H5,8,9,10,11,12) |
| InChIKey | WRPDHMGXFGCCPT-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol?
The IUPAC name of 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol (CID 19821122) is 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol.
What is the SMILES notation for 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol?
The canonical SMILES for 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol is Nc1nc(N)c(N)c(NCCO)n1.
What is the InChIKey of 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol?
The InChIKey is WRPDHMGXFGCCPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N6O/c7-3-4(8)11-6(9)12-5(3)10-1-2-13/h13H,1-2,7H2,(H5,8,9,10,11,12).
What are the key properties of 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol?
2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol has a molecular weight of 184.20 g/mol, XLogP of -1.37, 3 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5,6-triaminopyrimidin-4-yl)amino]ethanol is sourced from PubChem (CID 19821122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).