C7H5F4NO2 — CID 19821163
1-(2,2,3,3-tetrafluoropropyl)pyrrole-2,5-dione (PubChem CID 19821163) has the molecular formula C7H5F4NO2 and a molecular weight of 211.11 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,2,3,3-tetrafluoropropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19821163 |
| Molecular Formula | C7H5F4NO2 |
| Molecular Weight | 211.11 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H5F4NO2/c8-6(9)7(10,11)3-12-4(13)1-2-5(12)14/h1-2,6H,3H2 |
| InChIKey | SYKPHFPYWMYETJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.11 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|