C30H20F10O4S — CID 19821208
1-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)-4-[4-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)phenyl]sulfanylbenzene (PubChem CID 19821208) has the molecular formula C30H20F10O4S and a molecular weight of 666.53 g/mol. Its IUPAC name is 1-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)-4-[4-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)phenyl]sulfanylbenzene.
| Compound Name | 1-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)-4-[4-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)phenyl]sulfanylbenzene |
|---|---|
| PubChem CID | 19821208 |
| Molecular Formula | C30H20F10O4S |
| Molecular Weight | 666.53 g/mol |
| Exact Mass | 666.09 |
| IUPAC Name | 1-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)-4-[4-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)phenyl]sulfanylbenzene |
| SMILES | FC(C(F)(F)F)C(F)(Oc1ccccc1)Oc1ccc(Sc2ccc(OC(F)(Oc3ccccc3)C(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H20F10O4S/c31-25(27(33,34)35)29(39,41-19-7-3-1-4-8-19)43-21-11-15-23(16-12-21)45-24-17-13-22(14-18-24)44-30(40,26(32)28(36,37)38)42-20-9-5-2-6-10-20/h1-18,25-26H |
| InChIKey | JKIALHJWYXHKBM-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.53 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|