C34H23F5O4S — CID 19821210
[4-[1,2,3,3,3-pentafluoro-1-(3-phenoxyphenoxy)propoxy]phenyl]-(4-phenylsulfanylphenyl)methanone (PubChem CID 19821210) has the molecular formula C34H23F5O4S and a molecular weight of 622.61 g/mol. Its IUPAC name is [4-[1,2,3,3,3-pentafluoro-1-(3-phenoxyphenoxy)propoxy]phenyl]-(4-phenylsulfanylphenyl)methanone.
| Compound Name | [4-[1,2,3,3,3-pentafluoro-1-(3-phenoxyphenoxy)propoxy]phenyl]-(4-phenylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 19821210 |
| Molecular Formula | C34H23F5O4S |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.12 |
| IUPAC Name | [4-[1,2,3,3,3-pentafluoro-1-(3-phenoxyphenoxy)propoxy]phenyl]-(4-phenylsulfanylphenyl)methanone |
| SMILES | O=C(c1ccc(OC(F)(Oc2cccc(Oc3ccccc3)c2)C(F)C(F)(F)F)cc1)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C34H23F5O4S/c35-32(33(36,37)38)34(39,43-28-11-7-10-27(22-28)41-25-8-3-1-4-9-25)42-26-18-14-23(15-19-26)31(40)24-16-20-30(21-17-24)44-29-12-5-2-6-13-29/h1-22,32H |
| InChIKey | KHFGNLMFJYLQEI-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|