About 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one
3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 19821793) has the molecular formula C13H7Cl2F6N3O
and a molecular weight of 406.11 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one |
| PubChem CID | 19821793 |
| Molecular Formula | C13H7Cl2F6N3O |
| Molecular Weight | 406.11 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | CNc1nc(C(F)(F)F)cc(=O)n1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H7Cl2F6N3O/c1-22-11-23-8(13(19,20)21)4-9(25)24(11)10-6(14)2-5(3-7(10)15)12(16,17)18/h2-4H,1H3,(H,22,23) |
| InChIKey | AZDFWFIFZLWGCW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.11 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one?
The IUPAC name of 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one (CID 19821793) is 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one.
What is the SMILES notation for 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one?
The canonical SMILES for 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one is CNc1nc(C(F)(F)F)cc(=O)n1-c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one?
The InChIKey is AZDFWFIFZLWGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl2F6N3O/c1-22-11-23-8(13(19,20)21)4-9(25)24(11)10-6(14)2-5(3-7(10)15)12(16,17)18/h2-4H,1H3,(H,22,23).
What are the key properties of 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one?
3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one has a molecular weight of 406.11 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-one is sourced from PubChem (CID 19821793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).