C27H35NO7 — CID 19822174
[4-hydroxy-2-methyl-2-[(4-nitrophenoxy)methyl]-7-(2,4,4-trimethylpentan-2-yl)-3,4-dihydrochromen-6-yl] acetate (PubChem CID 19822174) has the molecular formula C27H35NO7 and a molecular weight of 485.58 g/mol. Its IUPAC name is [4-hydroxy-2-methyl-2-[(4-nitrophenoxy)methyl]-7-(2,4,4-trimethylpentan-2-yl)-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [4-hydroxy-2-methyl-2-[(4-nitrophenoxy)methyl]-7-(2,4,4-trimethylpentan-2-yl)-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 19822174 |
| Molecular Formula | C27H35NO7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | [4-hydroxy-2-methyl-2-[(4-nitrophenoxy)methyl]-7-(2,4,4-trimethylpentan-2-yl)-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1C(C)(C)CC(C)(C)C)OC(C)(COc1ccc([N+](=O)[O-])cc1)CC2O |
| InChI | InChI=1S/C27H35NO7/c1-17(29)34-24-12-20-22(30)14-27(7,16-33-19-10-8-18(9-11-19)28(31)32)35-23(20)13-21(24)26(5,6)15-25(2,3)4/h8-13,22,30H,14-16H2,1-7H3 |
| InChIKey | SYQOLNBJJDLUAH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|