C36H49ClO7 — CID 19822237
ethyl 3-[4-[[6-acetyloxy-2-(3,7-dimethyloctyl)-5,7,8-trimethyl-4-oxo-3H-chromen-2-yl]methoxy]phenyl]-2-chloropropanoate (PubChem CID 19822237) has the molecular formula C36H49ClO7 and a molecular weight of 629.23 g/mol. Its IUPAC name is ethyl 3-[4-[[6-acetyloxy-2-(3,7-dimethyloctyl)-5,7,8-trimethyl-4-oxo-3H-chromen-2-yl]methoxy]phenyl]-2-chloropropanoate.
| Compound Name | ethyl 3-[4-[[6-acetyloxy-2-(3,7-dimethyloctyl)-5,7,8-trimethyl-4-oxo-3H-chromen-2-yl]methoxy]phenyl]-2-chloropropanoate |
|---|---|
| PubChem CID | 19822237 |
| Molecular Formula | C36H49ClO7 |
| Molecular Weight | 629.23 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | ethyl 3-[4-[[6-acetyloxy-2-(3,7-dimethyloctyl)-5,7,8-trimethyl-4-oxo-3H-chromen-2-yl]methoxy]phenyl]-2-chloropropanoate |
| SMILES | CCOC(=O)C(Cl)Cc1ccc(OCC2(CCC(C)CCCC(C)C)CC(=O)c3c(C)c(OC(C)=O)c(C)c(C)c3O2)cc1 |
| InChI | InChI=1S/C36H49ClO7/c1-9-41-35(40)30(37)19-28-13-15-29(16-14-28)42-21-36(18-17-23(4)12-10-11-22(2)3)20-31(39)32-26(7)33(43-27(8)38)24(5)25(6)34(32)44-36/h13-16,22-23,30H,9-12,17-21H2,1-8H3 |
| InChIKey | LEVCBHWFTIHLQF-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.23 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|