C16H28O8 — CID 19822390
diethyl 2-(1,4,7,10-tetraoxacyclododec-2-ylmethyl)propanedioate (PubChem CID 19822390) has the molecular formula C16H28O8 and a molecular weight of 348.39 g/mol. Its IUPAC name is diethyl 2-(1,4,7,10-tetraoxacyclododec-2-ylmethyl)propanedioate.
| Compound Name | diethyl 2-(1,4,7,10-tetraoxacyclododec-2-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 19822390 |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | diethyl 2-(1,4,7,10-tetraoxacyclododec-2-ylmethyl)propanedioate |
| SMILES | CCOC(=O)C(CC1COCCOCCOCCO1)C(=O)OCC |
| InChI | InChI=1S/C16H28O8/c1-3-22-15(17)14(16(18)23-4-2)11-13-12-21-8-7-19-5-6-20-9-10-24-13/h13-14H,3-12H2,1-2H3 |
| InChIKey | UGIZDNDDHNMFRL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|