C14H26N2O10 — CID 19822395
2,3-diamino-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3-dicarboxylic acid (PubChem CID 19822395) has the molecular formula C14H26N2O10 and a molecular weight of 382.37 g/mol. Its IUPAC name is 2,3-diamino-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3-dicarboxylic acid.
| Compound Name | 2,3-diamino-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 19822395 |
| Molecular Formula | C14H26N2O10 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2,3-diamino-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3-dicarboxylic acid |
| SMILES | NC1(C(=O)O)OCCOCCOCCOCCOCCOC1(N)C(=O)O |
| InChI | InChI=1S/C14H26N2O10/c15-13(11(17)18)14(16,12(19)20)26-10-8-24-6-4-22-2-1-21-3-5-23-7-9-25-13/h1-10,15-16H2,(H,17,18)(H,19,20) |
| InChIKey | BUDGRVSUUJHPAR-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |