About bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone
bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone (PubChem CID 19822594) has the molecular formula C13H10OS2
and a molecular weight of 246.36 g/mol. Its IUPAC name is bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone.
Molecular Properties
| Compound Name | bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone |
| PubChem CID | 19822594 |
| Molecular Formula | C13H10OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone |
| SMILES | O=C(C1=CCC(=S)C=C1)C1=CCC(=S)C=C1 |
| InChI | InChI=1S/C13H10OS2/c14-13(9-1-5-11(15)6-2-9)10-3-7-12(16)8-4-10/h1-5,7H,6,8H2 |
| InChIKey | WQHXUSNZMKVPNV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone?
The IUPAC name of bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone (CID 19822594) is bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone.
What is the SMILES notation for bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone?
The canonical SMILES for bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone is O=C(C1=CCC(=S)C=C1)C1=CCC(=S)C=C1.
What is the InChIKey of bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone?
The InChIKey is WQHXUSNZMKVPNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10OS2/c14-13(9-1-5-11(15)6-2-9)10-3-7-12(16)8-4-10/h1-5,7H,6,8H2.
What are the key properties of bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone?
bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone has a molecular weight of 246.36 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methanone is sourced from PubChem (CID 19822594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).