About 1-hydroxy-5-methyl-1,2,4-triazole
1-hydroxy-5-methyl-1,2,4-triazole (PubChem CID 19822781) has the molecular formula C3H5N3O
and a molecular weight of 99.09 g/mol. Its IUPAC name is 1-hydroxy-5-methyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-hydroxy-5-methyl-1,2,4-triazole |
| PubChem CID | 19822781 |
| Molecular Formula | C3H5N3O |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.04 |
| IUPAC Name | 1-hydroxy-5-methyl-1,2,4-triazole |
| SMILES | Cc1ncnn1O |
| InChI | InChI=1S/C3H5N3O/c1-3-4-2-5-6(3)7/h2,7H,1H3 |
| InChIKey | XUZWSBYQQFNWDT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-5-methyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-5-methyl-1,2,4-triazole?
The IUPAC name of 1-hydroxy-5-methyl-1,2,4-triazole (CID 19822781) is 1-hydroxy-5-methyl-1,2,4-triazole.
What is the SMILES notation for 1-hydroxy-5-methyl-1,2,4-triazole?
The canonical SMILES for 1-hydroxy-5-methyl-1,2,4-triazole is Cc1ncnn1O.
What is the InChIKey of 1-hydroxy-5-methyl-1,2,4-triazole?
The InChIKey is XUZWSBYQQFNWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O/c1-3-4-2-5-6(3)7/h2,7H,1H3.
What are the key properties of 1-hydroxy-5-methyl-1,2,4-triazole?
1-hydroxy-5-methyl-1,2,4-triazole has a molecular weight of 99.09 g/mol, XLogP of -0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-5-methyl-1,2,4-triazole is sourced from PubChem (CID 19822781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).