About 5-ethyl-1-hydroxy-1,2,4-triazole
5-ethyl-1-hydroxy-1,2,4-triazole (PubChem CID 19822785) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 5-ethyl-1-hydroxy-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-ethyl-1-hydroxy-1,2,4-triazole |
| PubChem CID | 19822785 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 5-ethyl-1-hydroxy-1,2,4-triazole |
| SMILES | CCc1ncnn1O |
| InChI | InChI=1S/C4H7N3O/c1-2-4-5-3-6-7(4)8/h3,8H,2H2,1H3 |
| InChIKey | FMNWHTVPCSKQAG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1-hydroxy-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-hydroxy-1,2,4-triazole?
The IUPAC name of 5-ethyl-1-hydroxy-1,2,4-triazole (CID 19822785) is 5-ethyl-1-hydroxy-1,2,4-triazole.
What is the SMILES notation for 5-ethyl-1-hydroxy-1,2,4-triazole?
The canonical SMILES for 5-ethyl-1-hydroxy-1,2,4-triazole is CCc1ncnn1O.
What is the InChIKey of 5-ethyl-1-hydroxy-1,2,4-triazole?
The InChIKey is FMNWHTVPCSKQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c1-2-4-5-3-6-7(4)8/h3,8H,2H2,1H3.
What are the key properties of 5-ethyl-1-hydroxy-1,2,4-triazole?
5-ethyl-1-hydroxy-1,2,4-triazole has a molecular weight of 113.12 g/mol, XLogP of 0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-hydroxy-1,2,4-triazole is sourced from PubChem (CID 19822785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).