About 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate
8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate (PubChem CID 19822898) has the molecular formula C35H41F3O4
and a molecular weight of 582.70 g/mol. Its IUPAC name is 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate.
Molecular Properties
| Compound Name | 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate |
| PubChem CID | 19822898 |
| Molecular Formula | C35H41F3O4 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccccc3C(=O)OCCCCCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C35H41F3O4/c1-2-3-4-6-9-14-27-17-19-28(20-18-27)29-21-23-30(24-22-29)33(39)42-32-16-11-10-15-31(32)34(40)41-26-13-8-5-7-12-25-35(36,37)38/h10-11,15-24H,2-9,12-14,25-26H2,1H3 |
| InChIKey | NJBNUFNFUZJALZ-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate?
The IUPAC name of 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate (CID 19822898) is 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate.
What is the SMILES notation for 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate?
The canonical SMILES for 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate is CCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccccc3C(=O)OCCCCCCCC(F)(F)F)cc2)cc1.
What is the InChIKey of 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate?
The InChIKey is NJBNUFNFUZJALZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H41F3O4/c1-2-3-4-6-9-14-27-17-19-28(20-18-27)29-21-23-30(24-22-29)33(39)42-32-16-11-10-15-31(32)34(40)41-26-13-8-5-7-12-25-35(36,37)38/h10-11,15-24H,2-9,12-14,25-26H2,1H3.
What are the key properties of 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate?
8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate has a molecular weight of 582.70 g/mol, XLogP of 10.15, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8,8-trifluorooctyl 2-[4-(4-heptylphenyl)benzoyl]oxybenzoate is sourced from PubChem (CID 19822898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).