C10H14N2O2 — CID 19822912
5-amino-2-hydroxy-N-propylbenzamide (PubChem CID 19822912) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-amino-2-hydroxy-N-propylbenzamide.
| Compound Name | 5-amino-2-hydroxy-N-propylbenzamide |
|---|---|
| PubChem CID | 19822912 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 5-amino-2-hydroxy-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(N)ccc1O |
| InChI | InChI=1S/C10H14N2O2/c1-2-5-12-10(14)8-6-7(11)3-4-9(8)13/h3-4,6,13H,2,5,11H2,1H3,(H,12,14) |
| InChIKey | RUZYCHGLLGOHJR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|