C14H20BrN — CID 19823465
8-bromo-N-butan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 19823465) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is 8-bromo-N-butan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 8-bromo-N-butan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 19823465 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 8-bromo-N-butan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCC(C)NC1CCc2cccc(Br)c2C1 |
| InChI | InChI=1S/C14H20BrN/c1-3-10(2)16-12-8-7-11-5-4-6-14(15)13(11)9-12/h4-6,10,12,16H,3,7-9H2,1-2H3 |
| InChIKey | DWYGUJFMHZZHGR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |