C27H26N2O3 — CID 19823518
2-(1,3-dioxoisoindol-2-yl)-N-(2,2-diphenylethyl)-N,2-dimethylpropanamide (PubChem CID 19823518) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(2,2-diphenylethyl)-N,2-dimethylpropanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2,2-diphenylethyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 19823518 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2,2-diphenylethyl)-N,2-dimethylpropanamide |
| SMILES | CN(CC(c1ccccc1)c1ccccc1)C(=O)C(C)(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H26N2O3/c1-27(2,29-24(30)21-16-10-11-17-22(21)25(29)31)26(32)28(3)18-23(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-17,23H,18H2,1-3H3 |
| InChIKey | MVZNDSAUPOGAEM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|