About 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride
4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride (PubChem CID 19823772) has the molecular formula C14H20Cl3NO
and a molecular weight of 324.68 g/mol. Its IUPAC name is 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride |
| PubChem CID | 19823772 |
| Molecular Formula | C14H20Cl3NO |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride |
| SMILES | Cl.NC(CCCO)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C14H19Cl2NO.ClH/c15-11-5-4-10(9-12(11)16)14(6-2-7-14)13(17)3-1-8-18;/h4-5,9,13,18H,1-3,6-8,17H2;1H |
| InChIKey | KEGRGOKTCTUBLI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride?
The IUPAC name of 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride (CID 19823772) is 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride.
What is the SMILES notation for 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride?
The canonical SMILES for 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride is Cl.NC(CCCO)C1(c2ccc(Cl)c(Cl)c2)CCC1.
What is the InChIKey of 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride?
The InChIKey is KEGRGOKTCTUBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2NO.ClH/c15-11-5-4-10(9-12(11)16)14(6-2-7-14)13(17)3-1-8-18;/h4-5,9,13,18H,1-3,6-8,17H2;1H.
What are the key properties of 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride?
4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride has a molecular weight of 324.68 g/mol, XLogP of 3.94, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-ol;hydrochloride is sourced from PubChem (CID 19823772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).