C17H17N — CID 19824115
6,6a,7,8,8a,12a-hexahydrobenzo[a]phenanthridine (PubChem CID 19824115) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 6,6a,7,8,8a,12a-hexahydrobenzo[a]phenanthridine.
| Compound Name | 6,6a,7,8,8a,12a-hexahydrobenzo[a]phenanthridine |
|---|---|
| PubChem CID | 19824115 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6,6a,7,8,8a,12a-hexahydrobenzo[a]phenanthridine |
| SMILES | C1=CC2CCC3NC=c4ccccc4=C3C2C=C1 |
| InChI | InChI=1S/C17H17N/c1-3-7-14-12(5-1)9-10-16-17(14)15-8-4-2-6-13(15)11-18-16/h1-8,11-12,14,16,18H,9-10H2 |
| InChIKey | PDAZQNHCZQTHSZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |