C21H35NO4 — CID 19825762
1-O-tert-butyl 2-O-octyl 3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate (PubChem CID 19825762) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-octyl 3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-octyl 3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 19825762 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 1-O-tert-butyl 2-O-octyl 3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)C1CC2CC=CC2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35NO4/c1-5-6-7-8-9-10-14-25-19(23)18-15-16-12-11-13-17(16)22(18)20(24)26-21(2,3)4/h11,13,16-18H,5-10,12,14-15H2,1-4H3 |
| InChIKey | USJPGFKRMDLBMA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|