About 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone
1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone (PubChem CID 19825832) has the molecular formula C18H21N3OS
and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone |
| PubChem CID | 19825832 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(N(C)C)cc2Sc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C18H21N3OS/c1-12(22)21-15-8-6-13(19(2)3)10-17(15)23-18-11-14(20(4)5)7-9-16(18)21/h6-11H,1-5H3 |
| InChIKey | JEOGFTYLESYHAM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone?
The IUPAC name of 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone (CID 19825832) is 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone.
What is the SMILES notation for 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone?
The canonical SMILES for 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone is CC(=O)N1c2ccc(N(C)C)cc2Sc2cc(N(C)C)ccc21.
What is the InChIKey of 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone?
The InChIKey is JEOGFTYLESYHAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3OS/c1-12(22)21-15-8-6-13(19(2)3)10-17(15)23-18-11-14(20(4)5)7-9-16(18)21/h6-11H,1-5H3.
What are the key properties of 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone?
1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone has a molecular weight of 327.45 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone is sourced from PubChem (CID 19825832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).