C11H13NS — CID 19826199
4,4a,4b,8a,9,9a-hexahydrothiopyrano[2,3-b]indole (PubChem CID 19826199) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 4,4a,4b,8a,9,9a-hexahydrothiopyrano[2,3-b]indole.
| Compound Name | 4,4a,4b,8a,9,9a-hexahydrothiopyrano[2,3-b]indole |
|---|---|
| PubChem CID | 19826199 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 4,4a,4b,8a,9,9a-hexahydrothiopyrano[2,3-b]indole |
| SMILES | C1=CC2NC3SC=CCC3C2C=C1 |
| InChI | InChI=1S/C11H13NS/c1-2-6-10-8(4-1)9-5-3-7-13-11(9)12-10/h1-4,6-12H,5H2 |
| InChIKey | KZLBXKQMXBKZGJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |