C19H38N4 — CID 19826374
N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanimidamide (PubChem CID 19826374) has the molecular formula C19H38N4 and a molecular weight of 322.54 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanimidamide.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanimidamide |
|---|---|
| PubChem CID | 19826374 |
| Molecular Formula | C19H38N4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanimidamide |
| SMILES | CC1(C)CC(/N=C/NC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C19H38N4/c1-16(2)9-14(10-17(3,4)22-16)20-13-21-15-11-18(5,6)23-19(7,8)12-15/h13-15,22-23H,9-12H2,1-8H3,(H,20,21) |
| InChIKey | GNYLTHFBULRDTI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|