About CID 19826521
CID 19826521 (PubChem CID 19826521) has the molecular formula C20H32BrOSi
and a molecular weight of 396.47 g/mol.
Molecular Properties
| Compound Name | CID 19826521 |
| PubChem CID | 19826521 |
| Molecular Formula | C20H32BrOSi |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)C(C)(C)COC1CC(C)(C)c2cc(Br)ccc2C1(C)C |
| InChI | InChI=1S/C20H32BrOSi/c1-18(2)12-17(22-13-19(3,4)23(7)8)20(5,6)15-10-9-14(21)11-16(15)18/h9-11,17H,12-13H2,1-8H3 |
| InChIKey | DFPXQNOOSNUDHG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19826521 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19826521?
The IUPAC name of CID 19826521 (CID 19826521) is not available.
What is the SMILES notation for CID 19826521?
The canonical SMILES for CID 19826521 is C[Si](C)C(C)(C)COC1CC(C)(C)c2cc(Br)ccc2C1(C)C.
What is the InChIKey of CID 19826521?
The InChIKey is DFPXQNOOSNUDHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32BrOSi/c1-18(2)12-17(22-13-19(3,4)23(7)8)20(5,6)15-10-9-14(21)11-16(15)18/h9-11,17H,12-13H2,1-8H3.
What are the key properties of CID 19826521?
CID 19826521 has a molecular weight of 396.47 g/mol, XLogP of 6.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19826521 is sourced from PubChem (CID 19826521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).