About 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine
1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine (PubChem CID 19826641) has the molecular formula C29H57N3
and a molecular weight of 447.80 g/mol. Its IUPAC name is 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine.
Molecular Properties
| Compound Name | 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine |
| PubChem CID | 19826641 |
| Molecular Formula | C29H57N3 |
| Molecular Weight | 447.80 g/mol |
| Exact Mass | 447.46 |
| IUPAC Name | 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine |
| SMILES | CCCCC(CC)C/N=C(\NCC(CC)CCCC)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C29H57N3/c1-5-9-17-25(7-3)23-30-29(31-24-26(8-4)18-10-6-2)32(27-19-13-11-14-20-27)28-21-15-12-16-22-28/h25-28H,5-24H2,1-4H3,(H,30,31) |
| InChIKey | OWLSVRWWSJSKEZ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.80 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine?
The IUPAC name of 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine (CID 19826641) is 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine.
What is the SMILES notation for 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine?
The canonical SMILES for 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine is CCCCC(CC)C/N=C(\NCC(CC)CCCC)N(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine?
The InChIKey is OWLSVRWWSJSKEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H57N3/c1-5-9-17-25(7-3)23-30-29(31-24-26(8-4)18-10-6-2)32(27-19-13-11-14-20-27)28-21-15-12-16-22-28/h25-28H,5-24H2,1-4H3,(H,30,31).
What are the key properties of 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine?
1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine has a molecular weight of 447.80 g/mol, XLogP of 8.33, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dicyclohexyl-2,3-bis(2-ethylhexyl)guanidine is sourced from PubChem (CID 19826641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).