About bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate
bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate (PubChem CID 19827240) has the molecular formula C8H15O4P
and a molecular weight of 206.18 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate |
| PubChem CID | 19827240 |
| Molecular Formula | C8H15O4P |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate |
| SMILES | C1=CC2CCC1C2.COP(=O)(O)O |
| InChI | InChI=1S/C7H10.CH5O4P/c1-2-7-4-3-6(1)5-7;1-5-6(2,3)4/h1-2,6-7H,3-5H2;1H3,(H2,2,3,4) |
| InChIKey | ASJJJJRCHXWJRE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate (CID 19827240) is bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate is C1=CC2CCC1C2.COP(=O)(O)O.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate?
The InChIKey is ASJJJJRCHXWJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.CH5O4P/c1-2-7-4-3-6(1)5-7;1-5-6(2,3)4/h1-2,6-7H,3-5H2;1H3,(H2,2,3,4).
What are the key properties of bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate?
bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate has a molecular weight of 206.18 g/mol, XLogP of 1.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;methyl dihydrogen phosphate is sourced from PubChem (CID 19827240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).