About N,N-dibutylbutan-1-amine;N-ethylethanamine
N,N-dibutylbutan-1-amine;N-ethylethanamine (PubChem CID 19827528) has the molecular formula C16H38N2
and a molecular weight of 258.49 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;N-ethylethanamine.
Molecular Properties
| Compound Name | N,N-dibutylbutan-1-amine;N-ethylethanamine |
| PubChem CID | 19827528 |
| Molecular Formula | C16H38N2 |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 258.30 |
| IUPAC Name | N,N-dibutylbutan-1-amine;N-ethylethanamine |
| SMILES | CCCCN(CCCC)CCCC.CCNCC |
| InChI | InChI=1S/C12H27N.C4H11N/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3-5-4-2/h4-12H2,1-3H3;5H,3-4H2,1-2H3 |
| InChIKey | LONHRYRKKYEUNW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dibutylbutan-1-amine;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylbutan-1-amine;N-ethylethanamine?
The IUPAC name of N,N-dibutylbutan-1-amine;N-ethylethanamine (CID 19827528) is N,N-dibutylbutan-1-amine;N-ethylethanamine.
What is the SMILES notation for N,N-dibutylbutan-1-amine;N-ethylethanamine?
The canonical SMILES for N,N-dibutylbutan-1-amine;N-ethylethanamine is CCCCN(CCCC)CCCC.CCNCC.
What is the InChIKey of N,N-dibutylbutan-1-amine;N-ethylethanamine?
The InChIKey is LONHRYRKKYEUNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.C4H11N/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3-5-4-2/h4-12H2,1-3H3;5H,3-4H2,1-2H3.
What are the key properties of N,N-dibutylbutan-1-amine;N-ethylethanamine?
N,N-dibutylbutan-1-amine;N-ethylethanamine has a molecular weight of 258.49 g/mol, XLogP of 4.30, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylbutan-1-amine;N-ethylethanamine is sourced from PubChem (CID 19827528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).