About 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide
2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide (PubChem CID 19827563) has the molecular formula C6H10BrN5S
and a molecular weight of 264.15 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide.
Molecular Properties
| Compound Name | 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide |
| PubChem CID | 19827563 |
| Molecular Formula | C6H10BrN5S |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide |
| SMILES | C1=NN=N[NH2+]1.Cc1csc(C)n1.[Br-] |
| InChI | InChI=1S/C5H7NS.CH2N4.BrH/c1-4-3-7-5(2)6-4;1-2-4-5-3-1;/h3H,1-2H3;1H,(H,2,3,4,5);1H |
| InChIKey | PURKVOMWUCMAPM-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide?
The IUPAC name of 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide (CID 19827563) is 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide.
What is the SMILES notation for 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide?
The canonical SMILES for 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide is C1=NN=N[NH2+]1.Cc1csc(C)n1.[Br-].
What is the InChIKey of 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide?
The InChIKey is PURKVOMWUCMAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NS.CH2N4.BrH/c1-4-3-7-5(2)6-4;1-2-4-5-3-1;/h3H,1-2H3;1H,(H,2,3,4,5);1H.
What are the key properties of 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide?
2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide has a molecular weight of 264.15 g/mol, XLogP of -2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1,3-thiazole;1H-tetrazol-1-ium;bromide is sourced from PubChem (CID 19827563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).