C9H17N5O2 — CID 19827641
4-N,4-N-diethyl-2-N,2-N-dimethyl-5-nitro-1H-imidazole-2,4-diamine (PubChem CID 19827641) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2-N,2-N-dimethyl-5-nitro-1H-imidazole-2,4-diamine.
| Compound Name | 4-N,4-N-diethyl-2-N,2-N-dimethyl-5-nitro-1H-imidazole-2,4-diamine |
|---|---|
| PubChem CID | 19827641 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 4-N,4-N-diethyl-2-N,2-N-dimethyl-5-nitro-1H-imidazole-2,4-diamine |
| SMILES | CCN(CC)c1nc(N(C)C)[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H17N5O2/c1-5-13(6-2)7-8(14(15)16)11-9(10-7)12(3)4/h5-6H2,1-4H3,(H,10,11) |
| InChIKey | HEVVZIDQULEWSV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|