About methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride
methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride (PubChem CID 19828511) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride |
| PubChem CID | 19828511 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cccc2c1CNC2.Cl |
| InChI | InChI=1S/C10H11NO2.ClH/c1-13-10(12)8-4-2-3-7-5-11-6-9(7)8;/h2-4,11H,5-6H2,1H3;1H |
| InChIKey | ZEOILCADGXBXQW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride?
The IUPAC name of methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride (CID 19828511) is methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride.
What is the SMILES notation for methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride?
The canonical SMILES for methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride is COC(=O)c1cccc2c1CNC2.Cl.
What is the InChIKey of methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride?
The InChIKey is ZEOILCADGXBXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.ClH/c1-13-10(12)8-4-2-3-7-5-11-6-9(7)8;/h2-4,11H,5-6H2,1H3;1H.
What are the key properties of methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride?
methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride has a molecular weight of 213.66 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride is sourced from PubChem (CID 19828511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).