C25H32N2O4S — CID 19828519
2-[4-[3-(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 19828519) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is 2-[4-[3-(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-[3-(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 19828519 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 2-[4-[3-(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1cccc2c1CC(CCCNCCCCN1C(=O)c3ccccc3S1(=O)=O)CC2 |
| InChI | InChI=1S/C25H32N2O4S/c1-31-23-11-6-9-20-14-13-19(18-22(20)23)8-7-16-26-15-4-5-17-27-25(28)21-10-2-3-12-24(21)32(27,29)30/h2-3,6,9-12,19,26H,4-5,7-8,13-18H2,1H3 |
| InChIKey | CEWWULVEASBDSL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|