3,4-dihydroxy-5-methoxybenzoic acid

C8H8O5 — CID 19829

IUPAC3,4-dihydroxy-5-methoxybenzoic acid
SMILESCOc1cc(C(=O)O)cc(O)c1O
InChIInChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12)
InChIKeyKWCCUYSXAYTNKA-UHFFFAOYSA-N
MW184.15 g/mol
LogP0.80
Rot. Bonds2

About 3,4-dihydroxy-5-methoxybenzoic acid

3,4-dihydroxy-5-methoxybenzoic acid (PubChem CID 19829) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 3,4-dihydroxy-5-methoxybenzoic acid.

Molecular Properties

Compound Name3,4-dihydroxy-5-methoxybenzoic acid
PubChem CID19829
Molecular FormulaC8H8O5
Molecular Weight184.15 g/mol
Exact Mass184.04
IUPAC Name3,4-dihydroxy-5-methoxybenzoic acid
SMILESCOc1cc(C(=O)O)cc(O)c1O
InChIInChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12)
InChIKeyKWCCUYSXAYTNKA-UHFFFAOYSA-N
XLogP0.80
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 50.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 3,4-dihydroxy-5-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dihydroxy-5-methoxybenzoic acid?
The IUPAC name of 3,4-dihydroxy-5-methoxybenzoic acid (CID 19829) is 3,4-dihydroxy-5-methoxybenzoic acid.
What is the SMILES notation for 3,4-dihydroxy-5-methoxybenzoic acid?
The canonical SMILES for 3,4-dihydroxy-5-methoxybenzoic acid is COc1cc(C(=O)O)cc(O)c1O.
What is the InChIKey of 3,4-dihydroxy-5-methoxybenzoic acid?
The InChIKey is KWCCUYSXAYTNKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12).
What are the key properties of 3,4-dihydroxy-5-methoxybenzoic acid?
3,4-dihydroxy-5-methoxybenzoic acid has a molecular weight of 184.15 g/mol, XLogP of 0.80, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-5-methoxybenzoic acid is sourced from PubChem (CID 19829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).