C18H20N4O — CID 19829029
4-[5-(4-amino-2,3-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-2,3-dimethylaniline (PubChem CID 19829029) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-[5-(4-amino-2,3-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-2,3-dimethylaniline.
| Compound Name | 4-[5-(4-amino-2,3-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 19829029 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 4-[5-(4-amino-2,3-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-2,3-dimethylaniline |
| SMILES | Cc1c(N)ccc(-c2nnc(-c3ccc(N)c(C)c3C)o2)c1C |
| InChI | InChI=1S/C18H20N4O/c1-9-11(3)15(19)7-5-13(9)17-21-22-18(23-17)14-6-8-16(20)12(4)10(14)2/h5-8H,19-20H2,1-4H3 |
| InChIKey | AYODIDLADXZGBE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|