About 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one
3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 19829084) has the molecular formula C24H20O3
and a molecular weight of 356.42 g/mol. Its IUPAC name is 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 19829084 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CC(C)(C)c1ccc2c(c1)Oc1ccccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H20O3/c1-23(2,3)15-12-13-19-21(14-15)26-20-11-7-6-10-18(20)24(19)17-9-5-4-8-16(17)22(25)27-24/h4-14H,1-3H3 |
| InChIKey | ZSYWDCXAMULQHI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one (CID 19829084) is 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one is CC(C)(C)c1ccc2c(c1)Oc1ccccc1C21OC(=O)c2ccccc21.
What is the InChIKey of 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is ZSYWDCXAMULQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O3/c1-23(2,3)15-12-13-19-21(14-15)26-20-11-7-6-10-18(20)24(19)17-9-5-4-8-16(17)22(25)27-24/h4-14H,1-3H3.
What are the key properties of 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one?
3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 356.42 g/mol, XLogP of 5.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 19829084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).