About 2,2-difluorooxirane
2,2-difluorooxirane (PubChem CID 19829575) has the molecular formula C2H2F2O
and a molecular weight of 80.03 g/mol. Its IUPAC name is 2,2-difluorooxirane.
Molecular Properties
| Compound Name | 2,2-difluorooxirane |
| PubChem CID | 19829575 |
| Molecular Formula | C2H2F2O |
| Molecular Weight | 80.03 g/mol |
| Exact Mass | 80.01 |
| IUPAC Name | 2,2-difluorooxirane |
| SMILES | FC1(F)CO1 |
| InChI | InChI=1S/C2H2F2O/c3-2(4)1-5-2/h1H2 |
| InChIKey | ISBGUXAPKYJNKB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.03 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluorooxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluorooxirane?
The IUPAC name of 2,2-difluorooxirane (CID 19829575) is 2,2-difluorooxirane.
What is the SMILES notation for 2,2-difluorooxirane?
The canonical SMILES for 2,2-difluorooxirane is FC1(F)CO1.
What is the InChIKey of 2,2-difluorooxirane?
The InChIKey is ISBGUXAPKYJNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F2O/c3-2(4)1-5-2/h1H2.
What are the key properties of 2,2-difluorooxirane?
2,2-difluorooxirane has a molecular weight of 80.03 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluorooxirane is sourced from PubChem (CID 19829575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).