C16H15N3O3 — CID 19829816
1-[3-(4-methoxyphenyl)phenyl]-1,2,4-triazinane-3,5-dione (PubChem CID 19829816) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)phenyl]-1,2,4-triazinane-3,5-dione.
| Compound Name | 1-[3-(4-methoxyphenyl)phenyl]-1,2,4-triazinane-3,5-dione |
|---|---|
| PubChem CID | 19829816 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)phenyl]-1,2,4-triazinane-3,5-dione |
| SMILES | COc1ccc(-c2cccc(N3CC(=O)NC(=O)N3)c2)cc1 |
| InChI | InChI=1S/C16H15N3O3/c1-22-14-7-5-11(6-8-14)12-3-2-4-13(9-12)19-10-15(20)17-16(21)18-19/h2-9H,10H2,1H3,(H2,17,18,20,21) |
| InChIKey | KMGABCRWKKSIIL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |