About methyl 2-(3-iodoanilino)acetate
methyl 2-(3-iodoanilino)acetate (PubChem CID 19829858) has the molecular formula C9H10INO2
and a molecular weight of 291.09 g/mol. Its IUPAC name is methyl 2-(3-iodoanilino)acetate.
Molecular Properties
| Compound Name | methyl 2-(3-iodoanilino)acetate |
| PubChem CID | 19829858 |
| Molecular Formula | C9H10INO2 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | methyl 2-(3-iodoanilino)acetate |
| SMILES | COC(=O)CNc1cccc(I)c1 |
| InChI | InChI=1S/C9H10INO2/c1-13-9(12)6-11-8-4-2-3-7(10)5-8/h2-5,11H,6H2,1H3 |
| InChIKey | AKCIMRLLMVSUNN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3-iodoanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-iodoanilino)acetate?
The IUPAC name of methyl 2-(3-iodoanilino)acetate (CID 19829858) is methyl 2-(3-iodoanilino)acetate.
What is the SMILES notation for methyl 2-(3-iodoanilino)acetate?
The canonical SMILES for methyl 2-(3-iodoanilino)acetate is COC(=O)CNc1cccc(I)c1.
What is the InChIKey of methyl 2-(3-iodoanilino)acetate?
The InChIKey is AKCIMRLLMVSUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10INO2/c1-13-9(12)6-11-8-4-2-3-7(10)5-8/h2-5,11H,6H2,1H3.
What are the key properties of methyl 2-(3-iodoanilino)acetate?
methyl 2-(3-iodoanilino)acetate has a molecular weight of 291.09 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-iodoanilino)acetate is sourced from PubChem (CID 19829858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).