C9H8BrN3O2 — CID 19829907
1-(3-bromophenyl)-1,2,4-triazinane-3,5-dione (PubChem CID 19829907) has the molecular formula C9H8BrN3O2 and a molecular weight of 270.09 g/mol. Its IUPAC name is 1-(3-bromophenyl)-1,2,4-triazinane-3,5-dione.
| Compound Name | 1-(3-bromophenyl)-1,2,4-triazinane-3,5-dione |
|---|---|
| PubChem CID | 19829907 |
| Molecular Formula | C9H8BrN3O2 |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 1-(3-bromophenyl)-1,2,4-triazinane-3,5-dione |
| SMILES | O=C1CN(c2cccc(Br)c2)NC(=O)N1 |
| InChI | InChI=1S/C9H8BrN3O2/c10-6-2-1-3-7(4-6)13-5-8(14)11-9(15)12-13/h1-4H,5H2,(H2,11,12,14,15) |
| InChIKey | WICYUXCDURXISM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |