C12H29N5 — CID 19830403
1-N-ethenyl-1-N',1-N',1-N",1-N",2-N,2-N,2-N',2-N'-octamethylethane-1,1,1,2,2-pentamine (PubChem CID 19830403) has the molecular formula C12H29N5 and a molecular weight of 243.40 g/mol. Its IUPAC name is 1-N-ethenyl-1-N',1-N',1-N",1-N",2-N,2-N,2-N',2-N'-octamethylethane-1,1,1,2,2-pentamine.
| Compound Name | 1-N-ethenyl-1-N',1-N',1-N",1-N",2-N,2-N,2-N',2-N'-octamethylethane-1,1,1,2,2-pentamine |
|---|---|
| PubChem CID | 19830403 |
| Molecular Formula | C12H29N5 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.24 |
| IUPAC Name | 1-N-ethenyl-1-N',1-N',1-N",1-N",2-N,2-N,2-N',2-N'-octamethylethane-1,1,1,2,2-pentamine |
| SMILES | C=CNC(C(N(C)C)N(C)C)(N(C)C)N(C)C |
| InChI | InChI=1S/C12H29N5/c1-10-13-12(16(6)7,17(8)9)11(14(2)3)15(4)5/h10-11,13H,1H2,2-9H3 |
| InChIKey | CPJIHECWJPEDHE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 24.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|