About 3-methoxy-2,4,5-trimethylthiophene
3-methoxy-2,4,5-trimethylthiophene (PubChem CID 19831302) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is 3-methoxy-2,4,5-trimethylthiophene.
Molecular Properties
| Compound Name | 3-methoxy-2,4,5-trimethylthiophene |
| PubChem CID | 19831302 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 3-methoxy-2,4,5-trimethylthiophene |
| SMILES | COc1c(C)sc(C)c1C |
| InChI | InChI=1S/C8H12OS/c1-5-6(2)10-7(3)8(5)9-4/h1-4H3 |
| InChIKey | OHMNTVHAFCUYAM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2,4,5-trimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,4,5-trimethylthiophene?
The IUPAC name of 3-methoxy-2,4,5-trimethylthiophene (CID 19831302) is 3-methoxy-2,4,5-trimethylthiophene.
What is the SMILES notation for 3-methoxy-2,4,5-trimethylthiophene?
The canonical SMILES for 3-methoxy-2,4,5-trimethylthiophene is COc1c(C)sc(C)c1C.
What is the InChIKey of 3-methoxy-2,4,5-trimethylthiophene?
The InChIKey is OHMNTVHAFCUYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS/c1-5-6(2)10-7(3)8(5)9-4/h1-4H3.
What are the key properties of 3-methoxy-2,4,5-trimethylthiophene?
3-methoxy-2,4,5-trimethylthiophene has a molecular weight of 156.25 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,4,5-trimethylthiophene is sourced from PubChem (CID 19831302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).