C63H111N9O6 — CID 19831389
4-N,6-N,6-N-tributyl-2-N,2-N,4-N-tris(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-tricarboxamide (PubChem CID 19831389) has the molecular formula C63H111N9O6 and a molecular weight of 1090.64 g/mol. Its IUPAC name is 4-N,6-N,6-N-tributyl-2-N,2-N,4-N-tris(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-tricarboxamide.
| Compound Name | 4-N,6-N,6-N-tributyl-2-N,2-N,4-N-tris(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-tricarboxamide |
|---|---|
| PubChem CID | 19831389 |
| Molecular Formula | C63H111N9O6 |
| Molecular Weight | 1090.64 g/mol |
| Exact Mass | 1089.87 |
| IUPAC Name | 4-N,6-N,6-N-tributyl-2-N,2-N,4-N-tris(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-tricarboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1nc(C(=O)N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)nc(C(=O)N(C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1 |
| InChI | InChI=1S/C63H111N9O6/c1-16-19-37-67(38-20-17-2)55(73)52-64-53(56(74)68(39-21-18-3)46-40-58(4,5)70(59(6,7)41-46)76-49-31-25-22-26-32-49)66-54(65-52)57(75)69(47-42-60(8,9)71(61(10,11)43-47)77-50-33-27-23-28-34-50)48-44-62(12,13)72(63(14,15)45-48)78-51-35-29-24-30-36-51/h46-51H,16-45H2,1-15H3 |
| InChIKey | XFSPMWFPWKTDTC-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 137.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.64 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |