About 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride
1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride (PubChem CID 19831657) has the molecular formula C11H17Cl2NO
and a molecular weight of 250.17 g/mol. Its IUPAC name is 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride.
Molecular Properties
| Compound Name | 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride |
| PubChem CID | 19831657 |
| Molecular Formula | C11H17Cl2NO |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride |
| SMILES | Cc1cc(C)[n+](CC(O)CCl)c(C)c1.[Cl-] |
| InChI | InChI=1S/C11H17ClNO.ClH/c1-8-4-9(2)13(10(3)5-8)7-11(14)6-12;/h4-5,11,14H,6-7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CDTQYRNKIFWSCO-UHFFFAOYSA-M |
| XLogP | -1.50 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride?
The IUPAC name of 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride (CID 19831657) is 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride.
What is the SMILES notation for 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride?
The canonical SMILES for 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride is Cc1cc(C)[n+](CC(O)CCl)c(C)c1.[Cl-].
What is the InChIKey of 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride?
The InChIKey is CDTQYRNKIFWSCO-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H17ClNO.ClH/c1-8-4-9(2)13(10(3)5-8)7-11(14)6-12;/h4-5,11,14H,6-7H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride?
1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride has a molecular weight of 250.17 g/mol, XLogP of -1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propan-2-ol chloride is sourced from PubChem (CID 19831657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).