C17H12ClF6N3O3 — CID 19832671
2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-N-prop-2-enylbenzamide (PubChem CID 19832671) has the molecular formula C17H12ClF6N3O3 and a molecular weight of 455.74 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-N-prop-2-enylbenzamide.
| Compound Name | 2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 19832671 |
| Molecular Formula | C17H12ClF6N3O3 |
| Molecular Weight | 455.74 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cc(-n2c(=O)cc(C(F)(F)C(F)(F)F)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C17H12ClF6N3O3/c1-3-4-25-14(29)8-5-11(10(19)6-9(8)18)27-13(28)7-12(26(2)15(27)30)16(20,21)17(22,23)24/h3,5-7H,1,4H2,2H3,(H,25,29) |
| InChIKey | LFLPCLCHJKYIGF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|