About 2-isothiocyanato-4,6-dimethoxypyridine
2-isothiocyanato-4,6-dimethoxypyridine (PubChem CID 19832738) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-isothiocyanato-4,6-dimethoxypyridine.
Molecular Properties
| Compound Name | 2-isothiocyanato-4,6-dimethoxypyridine |
| PubChem CID | 19832738 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2-isothiocyanato-4,6-dimethoxypyridine |
| SMILES | COc1cc(N=C=S)nc(OC)c1 |
| InChI | InChI=1S/C8H8N2O2S/c1-11-6-3-7(9-5-13)10-8(4-6)12-2/h3-4H,1-2H3 |
| InChIKey | NPKVXKXNOVWRKE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-isothiocyanato-4,6-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isothiocyanato-4,6-dimethoxypyridine?
The IUPAC name of 2-isothiocyanato-4,6-dimethoxypyridine (CID 19832738) is 2-isothiocyanato-4,6-dimethoxypyridine.
What is the SMILES notation for 2-isothiocyanato-4,6-dimethoxypyridine?
The canonical SMILES for 2-isothiocyanato-4,6-dimethoxypyridine is COc1cc(N=C=S)nc(OC)c1.
What is the InChIKey of 2-isothiocyanato-4,6-dimethoxypyridine?
The InChIKey is NPKVXKXNOVWRKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-11-6-3-7(9-5-13)10-8(4-6)12-2/h3-4H,1-2H3.
What are the key properties of 2-isothiocyanato-4,6-dimethoxypyridine?
2-isothiocyanato-4,6-dimethoxypyridine has a molecular weight of 196.23 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isothiocyanato-4,6-dimethoxypyridine is sourced from PubChem (CID 19832738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).