About 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol
1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 19833115) has the molecular formula C8H11Cl2NO
and a molecular weight of 208.09 g/mol. Its IUPAC name is 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol |
| PubChem CID | 19833115 |
| Molecular Formula | C8H11Cl2NO |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | CC(O)C1C=CC(Cl)=CC1(N)Cl |
| InChI | InChI=1S/C8H11Cl2NO/c1-5(12)7-3-2-6(9)4-8(7,10)11/h2-5,7,12H,11H2,1H3 |
| InChIKey | UPDRTOXAKAYTFK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol?
The IUPAC name of 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol (CID 19833115) is 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol.
What is the SMILES notation for 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol?
The canonical SMILES for 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol is CC(O)C1C=CC(Cl)=CC1(N)Cl.
What is the InChIKey of 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol?
The InChIKey is UPDRTOXAKAYTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Cl2NO/c1-5(12)7-3-2-6(9)4-8(7,10)11/h2-5,7,12H,11H2,1H3.
What are the key properties of 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol?
1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol has a molecular weight of 208.09 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-4,6-dichlorocyclohexa-2,4-dien-1-yl)ethanol is sourced from PubChem (CID 19833115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).