C13H14ClN — CID 19833134
8-chloro-1,2,3,4,5,6-hexahydrobenzo[f]quinoline (PubChem CID 19833134) has the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. Its IUPAC name is 8-chloro-1,2,3,4,5,6-hexahydrobenzo[f]quinoline.
| Compound Name | 8-chloro-1,2,3,4,5,6-hexahydrobenzo[f]quinoline |
|---|---|
| PubChem CID | 19833134 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 8-chloro-1,2,3,4,5,6-hexahydrobenzo[f]quinoline |
| SMILES | Clc1ccc2c(c1)CCC1=C2CCCN1 |
| InChI | InChI=1S/C13H14ClN/c14-10-4-5-11-9(8-10)3-6-13-12(11)2-1-7-15-13/h4-5,8,15H,1-3,6-7H2 |
| InChIKey | LWBUFVBZEQZNDP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |