About 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole
1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole (PubChem CID 19833308) has the molecular formula C33H24N4O2
and a molecular weight of 508.58 g/mol. Its IUPAC name is 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole |
| PubChem CID | 19833308 |
| Molecular Formula | C33H24N4O2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc3ccccc3[nH]2)cc1.c1ccc(-c2nc3ccccc3o2)cc1.c1ccc2ocnc2c1 |
| InChI | InChI=1S/C13H10N2.C13H9NO.C7H5NO/c2*1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;1-2-4-7-6(3-1)8-5-9-7/h1-9H,(H,14,15);1-9H;1-5H |
| InChIKey | BBSZXNPSBBRXSP-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole?
The IUPAC name of 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole (CID 19833308) is 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole.
What is the SMILES notation for 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole?
The canonical SMILES for 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole is c1ccc(-c2nc3ccccc3[nH]2)cc1.c1ccc(-c2nc3ccccc3o2)cc1.c1ccc2ocnc2c1.
What is the InChIKey of 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole?
The InChIKey is BBSZXNPSBBRXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2.C13H9NO.C7H5NO/c2*1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;1-2-4-7-6(3-1)8-5-9-7/h1-9H,(H,14,15);1-9H;1-5H.
What are the key properties of 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole?
1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole has a molecular weight of 508.58 g/mol, XLogP of 8.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazole;2-phenyl-1H-benzimidazole;2-phenyl-1,3-benzoxazole is sourced from PubChem (CID 19833308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).