C28H33N3O — CID 19833333
1-hexyl-3,3,4,5-tetramethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] (PubChem CID 19833333) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-hexyl-3,3,4,5-tetramethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine].
| Compound Name | 1-hexyl-3,3,4,5-tetramethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] |
|---|---|
| PubChem CID | 19833333 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 1-hexyl-3,3,4,5-tetramethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] |
| SMILES | CCCCCCN1c2ccc(C)c(C)c2C(C)(C)C12C=Nc1c(ccc3ccncc13)O2 |
| InChI | InChI=1S/C28H33N3O/c1-6-7-8-9-16-31-23-12-10-19(2)20(3)25(23)27(4,5)28(31)18-30-26-22-17-29-15-14-21(22)11-13-24(26)32-28/h10-15,17-18H,6-9,16H2,1-5H3 |
| InChIKey | DPAHKXZKMSUFJB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|