C18H28ClNO — CID 19833473
2,4-dimethyl-9-(propylamino)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-1-ol;hydrochloride (PubChem CID 19833473) has the molecular formula C18H28ClNO and a molecular weight of 309.88 g/mol. Its IUPAC name is 2,4-dimethyl-9-(propylamino)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-1-ol;hydrochloride.
| Compound Name | 2,4-dimethyl-9-(propylamino)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-1-ol;hydrochloride |
|---|---|
| PubChem CID | 19833473 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2,4-dimethyl-9-(propylamino)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-1-ol;hydrochloride |
| SMILES | CCCNC1c2c(O)c(C)cc(C)c2C2CCCCC21.Cl |
| InChI | InChI=1S/C18H27NO.ClH/c1-4-9-19-17-14-8-6-5-7-13(14)15-11(2)10-12(3)18(20)16(15)17;/h10,13-14,17,19-20H,4-9H2,1-3H3;1H |
| InChIKey | LLFKGKZEWSAWMF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|